C13H26O3 — CID 6450417
(E,5R)-5,7,7-triethoxyhept-3-ene (PubChem CID 6450417) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is (E,5R)-5,7,7-triethoxyhept-3-ene.
| Compound Name | (E,5R)-5,7,7-triethoxyhept-3-ene |
|---|---|
| PubChem CID | 6450417 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | (E,5R)-5,7,7-triethoxyhept-3-ene |
| SMILES | CC/C=C/[C@@H](CC(OCC)OCC)OCC |
| InChI | InChI=1S/C13H26O3/c1-5-9-10-12(14-6-2)11-13(15-7-3)16-8-4/h9-10,12-13H,5-8,11H2,1-4H3/b10-9+/t12-/m0/s1 |
| InChIKey | YMPURWKRLGBYLD-VMPCVLLUSA-N |
| XLogP | 3.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|