C9H13BrO3 — CID 172746970
6-bromo-5-methoxy-5-(methoxymethoxy)cyclohexa-1,3-diene (PubChem CID 172746970) has the molecular formula C9H13BrO3 and a molecular weight of 249.10 g/mol. Its IUPAC name is 6-bromo-5-methoxy-5-(methoxymethoxy)cyclohexa-1,3-diene.
| Compound Name | 6-bromo-5-methoxy-5-(methoxymethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 172746970 |
| Molecular Formula | C9H13BrO3 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 6-bromo-5-methoxy-5-(methoxymethoxy)cyclohexa-1,3-diene |
| SMILES | COCOC1(OC)C=CC=CC1Br |
| InChI | InChI=1S/C9H13BrO3/c1-11-7-13-9(12-2)6-4-3-5-8(9)10/h3-6,8H,7H2,1-2H3 |
| InChIKey | JVWCWKKCKFQNCR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|