C9H13BrO2 — CID 142473612
1-bromo-2-(dimethoxymethyl)cyclohexa-1,3-diene (PubChem CID 142473612) has the molecular formula C9H13BrO2 and a molecular weight of 233.10 g/mol. Its IUPAC name is 1-bromo-2-(dimethoxymethyl)cyclohexa-1,3-diene.
| Compound Name | 1-bromo-2-(dimethoxymethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142473612 |
| Molecular Formula | C9H13BrO2 |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 1-bromo-2-(dimethoxymethyl)cyclohexa-1,3-diene |
| SMILES | COC(OC)C1=C(Br)CCC=C1 |
| InChI | InChI=1S/C9H13BrO2/c1-11-9(12-2)7-5-3-4-6-8(7)10/h3,5,9H,4,6H2,1-2H3 |
| InChIKey | SXGZSPFYNHQQPY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|