C12H19BrO3 — CID 141295514
5-bromo-5-(2,2-diethoxyethoxy)cyclohexa-1,3-diene (PubChem CID 141295514) has the molecular formula C12H19BrO3 and a molecular weight of 291.19 g/mol. Its IUPAC name is 5-bromo-5-(2,2-diethoxyethoxy)cyclohexa-1,3-diene.
| Compound Name | 5-bromo-5-(2,2-diethoxyethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141295514 |
| Molecular Formula | C12H19BrO3 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 5-bromo-5-(2,2-diethoxyethoxy)cyclohexa-1,3-diene |
| SMILES | CCOC(COC1(Br)C=CC=CC1)OCC |
| InChI | InChI=1S/C12H19BrO3/c1-3-14-11(15-4-2)10-16-12(13)8-6-5-7-9-12/h5-8,11H,3-4,9-10H2,1-2H3 |
| InChIKey | KTAGCSMDYLFZFJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|