C7H11BrO2 — CID 15420743
3-bromo-6-methoxy-2-methyl-3,6-dihydro-2H-pyran (PubChem CID 15420743) has the molecular formula C7H11BrO2 and a molecular weight of 207.07 g/mol. Its IUPAC name is 3-bromo-6-methoxy-2-methyl-3,6-dihydro-2H-pyran.
| Compound Name | 3-bromo-6-methoxy-2-methyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 15420743 |
| Molecular Formula | C7H11BrO2 |
| Molecular Weight | 207.07 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 3-bromo-6-methoxy-2-methyl-3,6-dihydro-2H-pyran |
| SMILES | COC1C=CC(Br)C(C)O1 |
| InChI | InChI=1S/C7H11BrO2/c1-5-6(8)3-4-7(9-2)10-5/h3-7H,1-2H3 |
| InChIKey | GYDWZUDSIPPJEE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.07 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|