C12H15BrF2N2 — CID 102637591
N-(2-bromocyclohexyl)-3,5-difluoro-N-methylpyridin-2-amine (PubChem CID 102637591) has the molecular formula C12H15BrF2N2 and a molecular weight of 305.17 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-3,5-difluoro-N-methylpyridin-2-amine.
| Compound Name | N-(2-bromocyclohexyl)-3,5-difluoro-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 102637591 |
| Molecular Formula | C12H15BrF2N2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(2-bromocyclohexyl)-3,5-difluoro-N-methylpyridin-2-amine |
| SMILES | CN(c1ncc(F)cc1F)C1CCCCC1Br |
| InChI | InChI=1S/C12H15BrF2N2/c1-17(11-5-3-2-4-9(11)13)12-10(15)6-8(14)7-16-12/h6-7,9,11H,2-5H2,1H3 |
| InChIKey | YYDFNRBKJBGYBF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|