C13H19BrN2 — CID 102637695
N-(2-bromocyclohexyl)-N,5-dimethylpyridin-2-amine (PubChem CID 102637695) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-N,5-dimethylpyridin-2-amine.
| Compound Name | N-(2-bromocyclohexyl)-N,5-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 102637695 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | N-(2-bromocyclohexyl)-N,5-dimethylpyridin-2-amine |
| SMILES | Cc1ccc(N(C)C2CCCCC2Br)nc1 |
| InChI | InChI=1S/C13H19BrN2/c1-10-7-8-13(15-9-10)16(2)12-6-4-3-5-11(12)14/h7-9,11-12H,3-6H2,1-2H3 |
| InChIKey | VJQINFOUZMXNMY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|