C15H18BrN3 — CID 102637721
N-(2-bromocyclohexyl)-N-methylquinazolin-2-amine (PubChem CID 102637721) has the molecular formula C15H18BrN3 and a molecular weight of 320.23 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-N-methylquinazolin-2-amine.
| Compound Name | N-(2-bromocyclohexyl)-N-methylquinazolin-2-amine |
|---|---|
| PubChem CID | 102637721 |
| Molecular Formula | C15H18BrN3 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-(2-bromocyclohexyl)-N-methylquinazolin-2-amine |
| SMILES | CN(c1ncc2ccccc2n1)C1CCCCC1Br |
| InChI | InChI=1S/C15H18BrN3/c1-19(14-9-5-3-7-12(14)16)15-17-10-11-6-2-4-8-13(11)18-15/h2,4,6,8,10,12,14H,3,5,7,9H2,1H3 |
| InChIKey | APKNRDAKNPONOZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|