C12H25NO2S — CID 102640730
2-ethenyl-N-ethyl-5-ethylsulfonyl-2-methylpentan-1-amine (PubChem CID 102640730) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is 2-ethenyl-N-ethyl-5-ethylsulfonyl-2-methylpentan-1-amine.
| Compound Name | 2-ethenyl-N-ethyl-5-ethylsulfonyl-2-methylpentan-1-amine |
|---|---|
| PubChem CID | 102640730 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-ethenyl-N-ethyl-5-ethylsulfonyl-2-methylpentan-1-amine |
| SMILES | C=CC(C)(CCCS(=O)(=O)CC)CNCC |
| InChI | InChI=1S/C12H25NO2S/c1-5-12(4,11-13-6-2)9-8-10-16(14,15)7-3/h5,13H,1,6-11H2,2-4H3 |
| InChIKey | YPPGWKFBGALCBH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|