C17H22ClNO — CID 102641160
N-[2-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-methylbut-3-enyl]cyclopropanamine (PubChem CID 102641160) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is N-[2-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-methylbut-3-enyl]cyclopropanamine.
| Compound Name | N-[2-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-methylbut-3-enyl]cyclopropanamine |
|---|---|
| PubChem CID | 102641160 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-[2-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-methylbut-3-enyl]cyclopropanamine |
| SMILES | C=CC(C)(CNC1CC1)Cc1cc(Cl)cc2c1OCC2 |
| InChI | InChI=1S/C17H22ClNO/c1-3-17(2,11-19-15-4-5-15)10-13-9-14(18)8-12-6-7-20-16(12)13/h3,8-9,15,19H,1,4-7,10-11H2,2H3 |
| InChIKey | MEISGFFYZQDTSF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|