C15H20BrClO — CID 113403801
7-[2-(bromomethyl)-2,3-dimethylbutyl]-5-chloro-2,3-dihydro-1-benzofuran (PubChem CID 113403801) has the molecular formula C15H20BrClO and a molecular weight of 331.68 g/mol. Its IUPAC name is 7-[2-(bromomethyl)-2,3-dimethylbutyl]-5-chloro-2,3-dihydro-1-benzofuran.
| Compound Name | 7-[2-(bromomethyl)-2,3-dimethylbutyl]-5-chloro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 113403801 |
| Molecular Formula | C15H20BrClO |
| Molecular Weight | 331.68 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 7-[2-(bromomethyl)-2,3-dimethylbutyl]-5-chloro-2,3-dihydro-1-benzofuran |
| SMILES | CC(C)C(C)(CBr)Cc1cc(Cl)cc2c1OCC2 |
| InChI | InChI=1S/C15H20BrClO/c1-10(2)15(3,9-16)8-12-7-13(17)6-11-4-5-18-14(11)12/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | FMNKEJANCRAEAO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|