C14H17ClO2 — CID 102641806
2-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-methylbut-3-en-1-ol (PubChem CID 102641806) has the molecular formula C14H17ClO2 and a molecular weight of 252.74 g/mol. Its IUPAC name is 2-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-methylbut-3-en-1-ol.
| Compound Name | 2-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 102641806 |
| Molecular Formula | C14H17ClO2 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-[(5-chloro-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-methylbut-3-en-1-ol |
| SMILES | C=CC(C)(CO)Cc1cc(Cl)cc2c1OCC2 |
| InChI | InChI=1S/C14H17ClO2/c1-3-14(2,9-16)8-11-7-12(15)6-10-4-5-17-13(10)11/h3,6-7,16H,1,4-5,8-9H2,2H3 |
| InChIKey | NPFWXGIISIDDDN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|