C15H14BrNO2 — CID 102654812
(3-bromoquinolin-2-yl)-(3,4-dihydro-2H-pyran-6-yl)methanol (PubChem CID 102654812) has the molecular formula C15H14BrNO2 and a molecular weight of 320.19 g/mol. Its IUPAC name is (3-bromoquinolin-2-yl)-(3,4-dihydro-2H-pyran-6-yl)methanol.
| Compound Name | (3-bromoquinolin-2-yl)-(3,4-dihydro-2H-pyran-6-yl)methanol |
|---|---|
| PubChem CID | 102654812 |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | (3-bromoquinolin-2-yl)-(3,4-dihydro-2H-pyran-6-yl)methanol |
| SMILES | OC(C1=CCCCO1)c1nc2ccccc2cc1Br |
| InChI | InChI=1S/C15H14BrNO2/c16-11-9-10-5-1-2-6-12(10)17-14(11)15(18)13-7-3-4-8-19-13/h1-2,5-7,9,15,18H,3-4,8H2 |
| InChIKey | PKHWAYSAKGIHMO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |