C13H18ClN5O — CID 102655217
4-(3-chlorophenyl)-3-(1,5-diaminopentyl)-1H-1,2,4-triazol-5-one (PubChem CID 102655217) has the molecular formula C13H18ClN5O and a molecular weight of 295.77 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-(1,5-diaminopentyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 4-(3-chlorophenyl)-3-(1,5-diaminopentyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 102655217 |
| Molecular Formula | C13H18ClN5O |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-(3-chlorophenyl)-3-(1,5-diaminopentyl)-1H-1,2,4-triazol-5-one |
| SMILES | NCCCCC(N)c1n[nH]c(=O)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClN5O/c14-9-4-3-5-10(8-9)19-12(17-18-13(19)20)11(16)6-1-2-7-15/h3-5,8,11H,1-2,6-7,15-16H2,(H,18,20) |
| InChIKey | IFKNSCXHLZNRPP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|