C14H18N6O — CID 102655218
4-[3-(1,5-diaminopentyl)-5-oxo-1H-1,2,4-triazol-4-yl]benzonitrile (PubChem CID 102655218) has the molecular formula C14H18N6O and a molecular weight of 286.34 g/mol. Its IUPAC name is 4-[3-(1,5-diaminopentyl)-5-oxo-1H-1,2,4-triazol-4-yl]benzonitrile.
| Compound Name | 4-[3-(1,5-diaminopentyl)-5-oxo-1H-1,2,4-triazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 102655218 |
| Molecular Formula | C14H18N6O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 4-[3-(1,5-diaminopentyl)-5-oxo-1H-1,2,4-triazol-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-n2c(C(N)CCCCN)n[nH]c2=O)cc1 |
| InChI | InChI=1S/C14H18N6O/c15-8-2-1-3-12(17)13-18-19-14(21)20(13)11-6-4-10(9-16)5-7-11/h4-7,12H,1-3,8,15,17H2,(H,19,21) |
| InChIKey | PTHQLXLASGOAIG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|