C10H19N5O — CID 102655210
4-cyclopropyl-3-(1,5-diaminopentyl)-1H-1,2,4-triazol-5-one (PubChem CID 102655210) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 4-cyclopropyl-3-(1,5-diaminopentyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 4-cyclopropyl-3-(1,5-diaminopentyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 102655210 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 4-cyclopropyl-3-(1,5-diaminopentyl)-1H-1,2,4-triazol-5-one |
| SMILES | NCCCCC(N)c1n[nH]c(=O)n1C1CC1 |
| InChI | InChI=1S/C10H19N5O/c11-6-2-1-3-8(12)9-13-14-10(16)15(9)7-4-5-7/h7-8H,1-6,11-12H2,(H,14,16) |
| InChIKey | BLWKDKMUDJBIQU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|