C12H22N2O4 — CID 102656384
1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-2-(3-methylazetidin-3-yl)oxyethanone (PubChem CID 102656384) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-2-(3-methylazetidin-3-yl)oxyethanone.
| Compound Name | 1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-2-(3-methylazetidin-3-yl)oxyethanone |
|---|---|
| PubChem CID | 102656384 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-2-(3-methylazetidin-3-yl)oxyethanone |
| SMILES | CC1COC(CO)CN1C(=O)COC1(C)CNC1 |
| InChI | InChI=1S/C12H22N2O4/c1-9-5-17-10(4-15)3-14(9)11(16)6-18-12(2)7-13-8-12/h9-10,13,15H,3-8H2,1-2H3 |
| InChIKey | LPXRDZJHOOVDSW-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |