C19H29NO — CID 10266085
4-cyclopentyl-6-(dimethylamino)-4-phenylhexan-3-one (PubChem CID 10266085) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 4-cyclopentyl-6-(dimethylamino)-4-phenylhexan-3-one.
| Compound Name | 4-cyclopentyl-6-(dimethylamino)-4-phenylhexan-3-one |
|---|---|
| PubChem CID | 10266085 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 4-cyclopentyl-6-(dimethylamino)-4-phenylhexan-3-one |
| SMILES | CCC(=O)C(CCN(C)C)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H29NO/c1-4-18(21)19(14-15-20(2)3,17-12-8-9-13-17)16-10-6-5-7-11-16/h5-7,10-11,17H,4,8-9,12-15H2,1-3H3 |
| InChIKey | JEPMJVFEYZKSDL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |