C48H46N2O4 — CID 18451590
N-hydroxy-N-[2-[hydroxy(3,3,3-triphenylpropanoyl)amino]cyclohexyl]-3,3,3-triphenylpropanamide (PubChem CID 18451590) has the molecular formula C48H46N2O4 and a molecular weight of 714.91 g/mol. Its IUPAC name is N-hydroxy-N-[2-[hydroxy(3,3,3-triphenylpropanoyl)amino]cyclohexyl]-3,3,3-triphenylpropanamide.
| Compound Name | N-hydroxy-N-[2-[hydroxy(3,3,3-triphenylpropanoyl)amino]cyclohexyl]-3,3,3-triphenylpropanamide |
|---|---|
| PubChem CID | 18451590 |
| Molecular Formula | C48H46N2O4 |
| Molecular Weight | 714.91 g/mol |
| Exact Mass | 714.35 |
| IUPAC Name | N-hydroxy-N-[2-[hydroxy(3,3,3-triphenylpropanoyl)amino]cyclohexyl]-3,3,3-triphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)(c1ccccc1)c1ccccc1)N(O)C1CCCCC1N(O)C(=O)CC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H46N2O4/c51-45(35-47(37-21-7-1-8-22-37,38-23-9-2-10-24-38)39-25-11-3-12-26-39)49(53)43-33-19-20-34-44(43)50(54)46(52)36-48(40-27-13-4-14-28-40,41-29-15-5-16-30-41)42-31-17-6-18-32-42/h1-18,21-32,43-44,53-54H,19-20,33-36H2 |
| InChIKey | VWHFLRGVWVBFFY-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.91 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|