C37H40N2O4 — CID 162400253
N-[(1R,2R)-2-[3,3-diphenylpropanoyl(methoxy)amino]cyclohexyl]-N-hydroxy-3,3-diphenylpropanamide (PubChem CID 162400253) has the molecular formula C37H40N2O4 and a molecular weight of 576.74 g/mol. Its IUPAC name is N-[(1R,2R)-2-[3,3-diphenylpropanoyl(methoxy)amino]cyclohexyl]-N-hydroxy-3,3-diphenylpropanamide.
| Compound Name | N-[(1R,2R)-2-[3,3-diphenylpropanoyl(methoxy)amino]cyclohexyl]-N-hydroxy-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 162400253 |
| Molecular Formula | C37H40N2O4 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | N-[(1R,2R)-2-[3,3-diphenylpropanoyl(methoxy)amino]cyclohexyl]-N-hydroxy-3,3-diphenylpropanamide |
| SMILES | CON(C(=O)CC(c1ccccc1)c1ccccc1)[C@@H]1CCCC[C@H]1N(O)C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H40N2O4/c1-43-39(37(41)27-33(30-20-10-4-11-21-30)31-22-12-5-13-23-31)35-25-15-14-24-34(35)38(42)36(40)26-32(28-16-6-2-7-17-28)29-18-8-3-9-19-29/h2-13,16-23,32-35,42H,14-15,24-27H2,1H3/t34-,35-/m1/s1 |
| InChIKey | SNROYDJQFNDQNZ-VSJLXWSYSA-N |
| XLogP | 7.35 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|