C35H35NO4 — CID 164671386
N-hydroxy-N-[(1R,2R)-2-(1-hydroxy-2-oxo-3,3-diphenylpropyl)cyclohexyl]-2,2-diphenylacetamide (PubChem CID 164671386) has the molecular formula C35H35NO4 and a molecular weight of 533.67 g/mol. Its IUPAC name is N-hydroxy-N-[(1R,2R)-2-(1-hydroxy-2-oxo-3,3-diphenylpropyl)cyclohexyl]-2,2-diphenylacetamide.
| Compound Name | N-hydroxy-N-[(1R,2R)-2-(1-hydroxy-2-oxo-3,3-diphenylpropyl)cyclohexyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 164671386 |
| Molecular Formula | C35H35NO4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | N-hydroxy-N-[(1R,2R)-2-(1-hydroxy-2-oxo-3,3-diphenylpropyl)cyclohexyl]-2,2-diphenylacetamide |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)C(O)[C@@H]1CCCC[C@H]1N(O)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H35NO4/c37-33(34(38)31(25-15-5-1-6-16-25)26-17-7-2-8-18-26)29-23-13-14-24-30(29)36(40)35(39)32(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-12,15-22,29-33,37,40H,13-14,23-24H2/t29-,30-,33?/m1/s1 |
| InChIKey | ZWIDPPVYBOYRKT-XMOVUWPTSA-N |
| XLogP | 6.36 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|