C17H12ClNO2 — CID 102669452
3-chloro-4-[[2-(3-hydroxyprop-1-ynyl)phenoxy]methyl]benzonitrile (PubChem CID 102669452) has the molecular formula C17H12ClNO2 and a molecular weight of 297.74 g/mol. Its IUPAC name is 3-chloro-4-[[2-(3-hydroxyprop-1-ynyl)phenoxy]methyl]benzonitrile.
| Compound Name | 3-chloro-4-[[2-(3-hydroxyprop-1-ynyl)phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 102669452 |
| Molecular Formula | C17H12ClNO2 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 3-chloro-4-[[2-(3-hydroxyprop-1-ynyl)phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccc(COc2ccccc2C#CCO)c(Cl)c1 |
| InChI | InChI=1S/C17H12ClNO2/c18-16-10-13(11-19)7-8-15(16)12-21-17-6-2-1-4-14(17)5-3-9-20/h1-2,4,6-8,10,20H,9,12H2 |
| InChIKey | YPUAZJXGWKDTCB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|