C10H16N4O2 — CID 102700639
3-hydrazinyl-N-(2-methoxypropyl)pyridine-4-carboxamide (PubChem CID 102700639) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-hydrazinyl-N-(2-methoxypropyl)pyridine-4-carboxamide.
| Compound Name | 3-hydrazinyl-N-(2-methoxypropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 102700639 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-hydrazinyl-N-(2-methoxypropyl)pyridine-4-carboxamide |
| SMILES | COC(C)CNC(=O)c1ccncc1NN |
| InChI | InChI=1S/C10H16N4O2/c1-7(16-2)5-13-10(15)8-3-4-12-6-9(8)14-11/h3-4,6-7,14H,5,11H2,1-2H3,(H,13,15) |
| InChIKey | UKBBCJWLLMCYIP-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|