C12H19N3O3 — CID 114101845
N-(2,3-dimethoxypropyl)-3-(methylamino)pyridine-4-carboxamide (PubChem CID 114101845) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(2,3-dimethoxypropyl)-3-(methylamino)pyridine-4-carboxamide.
| Compound Name | N-(2,3-dimethoxypropyl)-3-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114101845 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | N-(2,3-dimethoxypropyl)-3-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cnccc1C(=O)NCC(COC)OC |
| InChI | InChI=1S/C12H19N3O3/c1-13-11-7-14-5-4-10(11)12(16)15-6-9(18-3)8-17-2/h4-5,7,9,13H,6,8H2,1-3H3,(H,15,16) |
| InChIKey | UUCJWZKTPRATEW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |