C10H22N2O3S — CID 102700923
N'-(1,1-dioxothiolan-3-yl)-N-(2-methoxypropyl)ethane-1,2-diamine (PubChem CID 102700923) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N-(2-methoxypropyl)ethane-1,2-diamine.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N-(2-methoxypropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 102700923 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N-(2-methoxypropyl)ethane-1,2-diamine |
| SMILES | COC(C)CNCCNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H22N2O3S/c1-9(15-2)7-11-4-5-12-10-3-6-16(13,14)8-10/h9-12H,3-8H2,1-2H3 |
| InChIKey | TXNHRRXDBPKHAW-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|