C25H24N2O — CID 10270397
N,N-diethyl-3-[2-(2-phenylphenyl)-1,3-oxazol-5-yl]aniline (PubChem CID 10270397) has the molecular formula C25H24N2O and a molecular weight of 368.48 g/mol. Its IUPAC name is N,N-diethyl-3-[2-(2-phenylphenyl)-1,3-oxazol-5-yl]aniline.
| Compound Name | N,N-diethyl-3-[2-(2-phenylphenyl)-1,3-oxazol-5-yl]aniline |
|---|---|
| PubChem CID | 10270397 |
| Molecular Formula | C25H24N2O |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N,N-diethyl-3-[2-(2-phenylphenyl)-1,3-oxazol-5-yl]aniline |
| SMILES | CCN(CC)c1cccc(-c2cnc(-c3ccccc3-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C25H24N2O/c1-3-27(4-2)21-14-10-13-20(17-21)24-18-26-25(28-24)23-16-9-8-15-22(23)19-11-6-5-7-12-19/h5-18H,3-4H2,1-2H3 |
| InChIKey | PUKQUWBXKDIVME-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |