C11H11F6NO3 — CID 102721644
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4,5-dimethoxyaniline (PubChem CID 102721644) has the molecular formula C11H11F6NO3 and a molecular weight of 319.20 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4,5-dimethoxyaniline.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 102721644 |
| Molecular Formula | C11H11F6NO3 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4,5-dimethoxyaniline |
| SMILES | COc1cc(N)c(OC(C(F)(F)F)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C11H11F6NO3/c1-19-7-3-5(18)6(4-8(7)20-2)21-9(10(12,13)14)11(15,16)17/h3-4,9H,18H2,1-2H3 |
| InChIKey | GDMGRMSROPHSIC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|