C8H11F6NO2 — CID 102721958
3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)oxan-4-amine (PubChem CID 102721958) has the molecular formula C8H11F6NO2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)oxan-4-amine.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)oxan-4-amine |
|---|---|
| PubChem CID | 102721958 |
| Molecular Formula | C8H11F6NO2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)oxan-4-amine |
| SMILES | NC1CCOCC1OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H11F6NO2/c9-7(10,11)6(8(12,13)14)17-5-3-16-2-1-4(5)15/h4-6H,1-3,15H2 |
| InChIKey | XWIHFXMITBMBAI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |