C10H14F6N2O2 — CID 102722259
1-(1,4-diazepan-1-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanone (PubChem CID 102722259) has the molecular formula C10H14F6N2O2 and a molecular weight of 308.22 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanone.
| Compound Name | 1-(1,4-diazepan-1-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanone |
|---|---|
| PubChem CID | 102722259 |
| Molecular Formula | C10H14F6N2O2 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanone |
| SMILES | O=C(COC(C(F)(F)F)C(F)(F)F)N1CCCNCC1 |
| InChI | InChI=1S/C10H14F6N2O2/c11-9(12,13)8(10(14,15)16)20-6-7(19)18-4-1-2-17-3-5-18/h8,17H,1-6H2 |
| InChIKey | XLIRNPVORINCLH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |