C5H6F6N2O — CID 102722346
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanimidamide (PubChem CID 102722346) has the molecular formula C5H6F6N2O and a molecular weight of 224.10 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanimidamide.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanimidamide |
|---|---|
| PubChem CID | 102722346 |
| Molecular Formula | C5H6F6N2O |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanimidamide |
| SMILES | [H]/N=C(\N)COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H6F6N2O/c6-4(7,8)3(5(9,10)11)14-1-2(12)13/h3H,1H2,(H3,12,13) |
| InChIKey | DFNNQLHUHKZOPE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|