C19H17F6N3O — CID 123931950
3-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)phenyl]-3-phenyliminopropanimidamide (PubChem CID 123931950) has the molecular formula C19H17F6N3O and a molecular weight of 417.35 g/mol. Its IUPAC name is 3-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)phenyl]-3-phenyliminopropanimidamide.
| Compound Name | 3-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)phenyl]-3-phenyliminopropanimidamide |
|---|---|
| PubChem CID | 123931950 |
| Molecular Formula | C19H17F6N3O |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 3-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)phenyl]-3-phenyliminopropanimidamide |
| SMILES | [H]/N=C(\N)C/C(=N\c1ccccc1)c1cccc(COC(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F6N3O/c20-18(21,22)17(19(23,24)25)29-11-12-5-4-6-13(9-12)15(10-16(26)27)28-14-7-2-1-3-8-14/h1-9,17H,10-11H2,(H3,26,27)/b28-15+ |
| InChIKey | PRUIHXWLLLCQDZ-RWPZCVJISA-N |
| XLogP | 5.14 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|