C19H19F4N3O — CID 123969524
3-(4-fluorophenyl)imino-3-[3-[[(2R)-1,1,1-trifluoropropan-2-yl]oxymethyl]phenyl]propanimidamide (PubChem CID 123969524) has the molecular formula C19H19F4N3O and a molecular weight of 381.37 g/mol. Its IUPAC name is 3-(4-fluorophenyl)imino-3-[3-[[(2R)-1,1,1-trifluoropropan-2-yl]oxymethyl]phenyl]propanimidamide.
| Compound Name | 3-(4-fluorophenyl)imino-3-[3-[[(2R)-1,1,1-trifluoropropan-2-yl]oxymethyl]phenyl]propanimidamide |
|---|---|
| PubChem CID | 123969524 |
| Molecular Formula | C19H19F4N3O |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-(4-fluorophenyl)imino-3-[3-[[(2R)-1,1,1-trifluoropropan-2-yl]oxymethyl]phenyl]propanimidamide |
| SMILES | [H]/N=C(\N)C/C(=N\c1ccc(F)cc1)c1cccc(CO[C@H](C)C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F4N3O/c1-12(19(21,22)23)27-11-13-3-2-4-14(9-13)17(10-18(24)25)26-16-7-5-15(20)6-8-16/h2-9,12H,10-11H2,1H3,(H3,24,25)/b26-17+/t12-/m1/s1 |
| InChIKey | USJKRMMUJLKBHN-PTYVEDSISA-N |
| XLogP | 4.74 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|