C10H9F6N3O — CID 102722365
4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 102722365) has the molecular formula C10H9F6N3O and a molecular weight of 301.19 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 102722365 |
| Molecular Formula | C10H9F6N3O |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| SMILES | FC(F)(F)C(Oc1ncnc2c1CNCC2)C(F)(F)F |
| InChI | InChI=1S/C10H9F6N3O/c11-9(12,13)8(10(14,15)16)20-7-5-3-17-2-1-6(5)18-4-19-7/h4,8,17H,1-3H2 |
| InChIKey | ZIKXDUGFSWVRLB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |