C11H18N2O3 — CID 102735221
1-ethyl-4-[(1S,2S)-2-hydroxycyclopentyl]piperazine-2,5-dione (PubChem CID 102735221) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-ethyl-4-[(1S,2S)-2-hydroxycyclopentyl]piperazine-2,5-dione.
| Compound Name | 1-ethyl-4-[(1S,2S)-2-hydroxycyclopentyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 102735221 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1-ethyl-4-[(1S,2S)-2-hydroxycyclopentyl]piperazine-2,5-dione |
| SMILES | CCN1CC(=O)N([C@H]2CCC[C@@H]2O)CC1=O |
| InChI | InChI=1S/C11H18N2O3/c1-2-12-6-11(16)13(7-10(12)15)8-4-3-5-9(8)14/h8-9,14H,2-7H2,1H3/t8-,9-/m0/s1 |
| InChIKey | KKBODGPCPSZMDP-IUCAKERBSA-N |
| XLogP | -0.41 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |