C8H6Cl2F4N2O — CID 102760348
3,5-dichloro-6-(2,2,3,3-tetrafluoropropoxy)pyridin-2-amine (PubChem CID 102760348) has the molecular formula C8H6Cl2F4N2O and a molecular weight of 293.05 g/mol. Its IUPAC name is 3,5-dichloro-6-(2,2,3,3-tetrafluoropropoxy)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(2,2,3,3-tetrafluoropropoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 102760348 |
| Molecular Formula | C8H6Cl2F4N2O |
| Molecular Weight | 293.05 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 3,5-dichloro-6-(2,2,3,3-tetrafluoropropoxy)pyridin-2-amine |
| SMILES | Nc1nc(OCC(F)(F)C(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl2F4N2O/c9-3-1-4(10)6(16-5(3)15)17-2-8(13,14)7(11)12/h1,7H,2H2,(H2,15,16) |
| InChIKey | PNMPMGDRKPKBQW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.05 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|