C13H10F4N2 — CID 102817542
3-fluoro-5-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]benzonitrile (PubChem CID 102817542) has the molecular formula C13H10F4N2 and a molecular weight of 270.23 g/mol. Its IUPAC name is 3-fluoro-5-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]benzonitrile.
| Compound Name | 3-fluoro-5-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 102817542 |
| Molecular Formula | C13H10F4N2 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 3-fluoro-5-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]benzonitrile |
| SMILES | N#Cc1cc(F)cc(N2CC=C(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C13H10F4N2/c14-11-5-9(8-18)6-12(7-11)19-3-1-10(2-4-19)13(15,16)17/h1,5-7H,2-4H2 |
| InChIKey | FDXLALUHHBSUDR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|