C30H35N3O9 — CID 10281769
butyl 3-[(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]prop-2-ynoate (PubChem CID 10281769) has the molecular formula C30H35N3O9 and a molecular weight of 581.62 g/mol. Its IUPAC name is butyl 3-[(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]prop-2-ynoate.
| Compound Name | butyl 3-[(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]prop-2-ynoate |
|---|---|
| PubChem CID | 10281769 |
| Molecular Formula | C30H35N3O9 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | butyl 3-[(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]prop-2-ynoate |
| SMILES | CCCCOC(=O)C#Cc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C30H35N3O9/c1-6-7-10-42-19(34)9-8-14-13-18(32(2)3)16-11-15-12-17-23(33(4)5)26(37)22(29(31)40)28(39)30(17,41)27(38)20(15)25(36)21(16)24(14)35/h13,15,17,20,22-23,35,41H,6-7,10-12H2,1-5H3,(H2,31,40)/t15-,17-,20?,22?,23-,30-/m0/s1 |
| InChIKey | ZYULLPRDTMAOSF-XONKXQHQSA-N |
| XLogP | -0.37 |
| TPSA | 184.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|