C27H32N4O9S — CID 91048364
(4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[3-(methanesulfonamido)prop-1-ynyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91048364) has the molecular formula C27H32N4O9S and a molecular weight of 588.64 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[3-(methanesulfonamido)prop-1-ynyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[3-(methanesulfonamido)prop-1-ynyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91048364 |
| Molecular Formula | C27H32N4O9S |
| Molecular Weight | 588.64 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[3-(methanesulfonamido)prop-1-ynyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(C#CCNS(C)(=O)=O)c(O)c2c1C[C@@H]1C[C@@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C27H32N4O9S/c1-30(2)16-11-12(7-6-8-29-41(5,39)40)21(32)18-14(16)9-13-10-15-20(31(3)4)23(34)19(26(28)37)25(36)27(15,38)24(35)17(13)22(18)33/h11,13,15,17,19-20,29,32,38H,8-10H2,1-5H3,(H2,28,37)/t13-,15-,17?,19?,20-,27-/m1/s1 |
| InChIKey | PXZLXHKRECFKFU-IWWSELALSA-N |
| XLogP | -2.17 |
| TPSA | 204.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.64 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|