C25H21Br2N3O3S — CID 10282258
5-bromo-N-(4-bromophenyl)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]benzamide (PubChem CID 10282258) has the molecular formula C25H21Br2N3O3S and a molecular weight of 603.34 g/mol. Its IUPAC name is 5-bromo-N-(4-bromophenyl)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]benzamide.
| Compound Name | 5-bromo-N-(4-bromophenyl)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 10282258 |
| Molecular Formula | C25H21Br2N3O3S |
| Molecular Weight | 603.34 g/mol |
| Exact Mass | 600.97 |
| IUPAC Name | 5-bromo-N-(4-bromophenyl)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]benzamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)Nc3ccc(Br)cc3C(=O)Nc3ccc(Br)cc3)cccc12 |
| InChI | InChI=1S/C25H21Br2N3O3S/c1-30(2)23-7-3-6-20-19(23)5-4-8-24(20)34(32,33)29-22-14-11-17(27)15-21(22)25(31)28-18-12-9-16(26)10-13-18/h3-15,29H,1-2H3,(H,28,31) |
| InChIKey | OQPOOSLBKVTIDZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.34 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |