C14H9Br2F3N2O3S — CID 174449375
5-bromo-N-(4-bromophenyl)-2-(trifluoromethylsulfonylamino)benzamide (PubChem CID 174449375) has the molecular formula C14H9Br2F3N2O3S and a molecular weight of 502.11 g/mol. Its IUPAC name is 5-bromo-N-(4-bromophenyl)-2-(trifluoromethylsulfonylamino)benzamide.
| Compound Name | 5-bromo-N-(4-bromophenyl)-2-(trifluoromethylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 174449375 |
| Molecular Formula | C14H9Br2F3N2O3S |
| Molecular Weight | 502.11 g/mol |
| Exact Mass | 499.87 |
| IUPAC Name | 5-bromo-N-(4-bromophenyl)-2-(trifluoromethylsulfonylamino)benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1cc(Br)ccc1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H9Br2F3N2O3S/c15-8-1-4-10(5-2-8)20-13(22)11-7-9(16)3-6-12(11)21-25(23,24)14(17,18)19/h1-7,21H,(H,20,22) |
| InChIKey | AWTFFPPPPXPCKV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.11 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |