C11H6ClF2N — CID 102825119
4-chloro-2-(2,6-difluorophenyl)pyridine (PubChem CID 102825119) has the molecular formula C11H6ClF2N and a molecular weight of 225.63 g/mol. Its IUPAC name is 4-chloro-2-(2,6-difluorophenyl)pyridine.
| Compound Name | 4-chloro-2-(2,6-difluorophenyl)pyridine |
|---|---|
| PubChem CID | 102825119 |
| Molecular Formula | C11H6ClF2N |
| Molecular Weight | 225.63 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 4-chloro-2-(2,6-difluorophenyl)pyridine |
| SMILES | Fc1cccc(F)c1-c1cc(Cl)ccn1 |
| InChI | InChI=1S/C11H6ClF2N/c12-7-4-5-15-10(6-7)11-8(13)2-1-3-9(11)14/h1-6H |
| InChIKey | XJRVYJRBSWNXGS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |