C40H49N3O5 — CID 10283083
2-(diethylamino)ethyl 4-[[(2R)-2-(benzylamino)-3-(4-phenylmethoxyphenyl)propanoyl]amino]-3-butoxybenzoate (PubChem CID 10283083) has the molecular formula C40H49N3O5 and a molecular weight of 651.85 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[[(2R)-2-(benzylamino)-3-(4-phenylmethoxyphenyl)propanoyl]amino]-3-butoxybenzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[[(2R)-2-(benzylamino)-3-(4-phenylmethoxyphenyl)propanoyl]amino]-3-butoxybenzoate |
|---|---|
| PubChem CID | 10283083 |
| Molecular Formula | C40H49N3O5 |
| Molecular Weight | 651.85 g/mol |
| Exact Mass | 651.37 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[[(2R)-2-(benzylamino)-3-(4-phenylmethoxyphenyl)propanoyl]amino]-3-butoxybenzoate |
| SMILES | CCCCOc1cc(C(=O)OCCN(CC)CC)ccc1NC(=O)[C@@H](Cc1ccc(OCc2ccccc2)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C40H49N3O5/c1-4-7-25-46-38-28-34(40(45)47-26-24-43(5-2)6-3)20-23-36(38)42-39(44)37(41-29-32-14-10-8-11-15-32)27-31-18-21-35(22-19-31)48-30-33-16-12-9-13-17-33/h8-23,28,37,41H,4-7,24-27,29-30H2,1-3H3,(H,42,44)/t37-/m1/s1 |
| InChIKey | MYUNAAKMJHEORE-DIPNUNPCSA-N |
| XLogP | 7.28 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.85 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|