C30H39N3O4 — CID 10188384
2-(diethylamino)ethyl 4-[[(2R)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-3-butoxybenzoate (PubChem CID 10188384) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[[(2R)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-3-butoxybenzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[[(2R)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-3-butoxybenzoate |
|---|---|
| PubChem CID | 10188384 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[[(2R)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-3-butoxybenzoate |
| SMILES | CCCCOc1cc(C(=O)OCCN(CC)CC)ccc1NC(=O)[C@H](N)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H39N3O4/c1-4-7-17-36-28-21-25(30(35)37-18-16-33(5-2)6-3)14-15-27(28)32-29(34)26(31)20-22-12-13-23-10-8-9-11-24(23)19-22/h8-15,19,21,26H,4-7,16-18,20,31H2,1-3H3,(H,32,34)/t26-/m1/s1 |
| InChIKey | TWTFYZVOMVJLGE-AREMUKBSSA-N |
| XLogP | 5.03 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|