C34H47N3O7S — CID 142099681
2-(diethylamino)ethyl 3-butoxy-4-[[(2R)-2-(methanesulfonamido)-3-[4-[(3Z)-2-methylidenehexa-3,5-dienoxy]phenyl]propanoyl]amino]benzoate (PubChem CID 142099681) has the molecular formula C34H47N3O7S and a molecular weight of 641.83 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-butoxy-4-[[(2R)-2-(methanesulfonamido)-3-[4-[(3Z)-2-methylidenehexa-3,5-dienoxy]phenyl]propanoyl]amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 3-butoxy-4-[[(2R)-2-(methanesulfonamido)-3-[4-[(3Z)-2-methylidenehexa-3,5-dienoxy]phenyl]propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 142099681 |
| Molecular Formula | C34H47N3O7S |
| Molecular Weight | 641.83 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | 2-(diethylamino)ethyl 3-butoxy-4-[[(2R)-2-(methanesulfonamido)-3-[4-[(3Z)-2-methylidenehexa-3,5-dienoxy]phenyl]propanoyl]amino]benzoate |
| SMILES | C=C/C=C\C(=C)COc1ccc(C[C@@H](NS(C)(=O)=O)C(=O)Nc2ccc(C(=O)OCCN(CC)CC)cc2OCCCC)cc1 |
| InChI | InChI=1S/C34H47N3O7S/c1-7-11-13-26(5)25-44-29-17-14-27(15-18-29)23-31(36-45(6,40)41)33(38)35-30-19-16-28(24-32(30)42-21-12-8-2)34(39)43-22-20-37(9-3)10-4/h7,11,13-19,24,31,36H,1,5,8-10,12,20-23,25H2,2-4,6H3,(H,35,38)/b13-11-/t31-/m1/s1 |
| InChIKey | WGEJXTGKKJVZBT-OPIPOUMXSA-N |
| XLogP | 5.14 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.83 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|