C10H11BrClN3S — CID 102835699
1-(4-bromo-5-chlorothiophen-2-yl)-N-[(1-methylimidazol-2-yl)methyl]methanamine (PubChem CID 102835699) has the molecular formula C10H11BrClN3S and a molecular weight of 320.64 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-N-[(1-methylimidazol-2-yl)methyl]methanamine.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-[(1-methylimidazol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 102835699 |
| Molecular Formula | C10H11BrClN3S |
| Molecular Weight | 320.64 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-[(1-methylimidazol-2-yl)methyl]methanamine |
| SMILES | Cn1ccnc1CNCc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C10H11BrClN3S/c1-15-3-2-14-9(15)6-13-5-7-4-8(11)10(12)16-7/h2-4,13H,5-6H2,1H3 |
| InChIKey | BDBGOBSTKYJTRR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |