C9H9BrClN3S — CID 102836241
1-(4-bromo-5-chlorothiophen-2-yl)-N-(1H-imidazol-5-ylmethyl)methanamine (PubChem CID 102836241) has the molecular formula C9H9BrClN3S and a molecular weight of 306.62 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-N-(1H-imidazol-5-ylmethyl)methanamine.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-(1H-imidazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 102836241 |
| Molecular Formula | C9H9BrClN3S |
| Molecular Weight | 306.62 g/mol |
| Exact Mass | 304.94 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-(1H-imidazol-5-ylmethyl)methanamine |
| SMILES | Clc1sc(CNCc2cnc[nH]2)cc1Br |
| InChI | InChI=1S/C9H9BrClN3S/c10-8-1-7(15-9(8)11)4-12-2-6-3-13-5-14-6/h1,3,5,12H,2,4H2,(H,13,14) |
| InChIKey | YVZDZVNUAYRZSI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |