C13H13Br2NOS — CID 102843326
2-(benzylamino)-2-(4,5-dibromothiophen-2-yl)ethanol (PubChem CID 102843326) has the molecular formula C13H13Br2NOS and a molecular weight of 391.13 g/mol. Its IUPAC name is 2-(benzylamino)-2-(4,5-dibromothiophen-2-yl)ethanol.
| Compound Name | 2-(benzylamino)-2-(4,5-dibromothiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 102843326 |
| Molecular Formula | C13H13Br2NOS |
| Molecular Weight | 391.13 g/mol |
| Exact Mass | 388.91 |
| IUPAC Name | 2-(benzylamino)-2-(4,5-dibromothiophen-2-yl)ethanol |
| SMILES | OCC(NCc1ccccc1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H13Br2NOS/c14-10-6-12(18-13(10)15)11(8-17)16-7-9-4-2-1-3-5-9/h1-6,11,16-17H,7-8H2 |
| InChIKey | DTEWLDYNLJTFLA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.13 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |