5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid

C10H11Br2NO3S — CID 102844373

IUPAC5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid
SMILESO=CNC(CCC(=O)O)Cc1cc(Br)c(Br)s1
InChIInChI=1S/C10H11Br2NO3S/c11-8-4-7(17-10(8)12)3-6(13-5-14)1-2-9(15)16/h4-6H,1-3H2,(H,13,14)(H,15,16)
InChIKeyMIGRJBLQUQTLQZ-UHFFFAOYSA-N
MW385.08 g/mol
LogP2.80
Rot. Bonds7

About 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid

5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid (PubChem CID 102844373) has the molecular formula C10H11Br2NO3S and a molecular weight of 385.08 g/mol. Its IUPAC name is 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid.

Molecular Properties

Compound Name5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid
PubChem CID102844373
Molecular FormulaC10H11Br2NO3S
Molecular Weight385.08 g/mol
Exact Mass382.88
IUPAC Name5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid
SMILESO=CNC(CCC(=O)O)Cc1cc(Br)c(Br)s1
InChIInChI=1S/C10H11Br2NO3S/c11-8-4-7(17-10(8)12)3-6(13-5-14)1-2-9(15)16/h4-6H,1-3H2,(H,13,14)(H,15,16)
InChIKeyMIGRJBLQUQTLQZ-UHFFFAOYSA-N
XLogP2.80
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500385.08
LogP ≤ 52.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid?
The IUPAC name of 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid (CID 102844373) is 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid.
What is the SMILES notation for 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid?
The canonical SMILES for 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid is O=CNC(CCC(=O)O)Cc1cc(Br)c(Br)s1.
What is the InChIKey of 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid?
The InChIKey is MIGRJBLQUQTLQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Br2NO3S/c11-8-4-7(17-10(8)12)3-6(13-5-14)1-2-9(15)16/h4-6H,1-3H2,(H,13,14)(H,15,16).
What are the key properties of 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid?
5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid has a molecular weight of 385.08 g/mol, XLogP of 2.80, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid is sourced from PubChem (CID 102844373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).