C10H11Br2NO3S — CID 102844373
5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid (PubChem CID 102844373) has the molecular formula C10H11Br2NO3S and a molecular weight of 385.08 g/mol. Its IUPAC name is 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid.
| Compound Name | 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid |
|---|---|
| PubChem CID | 102844373 |
| Molecular Formula | C10H11Br2NO3S |
| Molecular Weight | 385.08 g/mol |
| Exact Mass | 382.88 |
| IUPAC Name | 5-(4,5-dibromothiophen-2-yl)-4-formamidopentanoic acid |
| SMILES | O=CNC(CCC(=O)O)Cc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H11Br2NO3S/c11-8-4-7(17-10(8)12)3-6(13-5-14)1-2-9(15)16/h4-6H,1-3H2,(H,13,14)(H,15,16) |
| InChIKey | MIGRJBLQUQTLQZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.08 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|