C9H10Br2N2OS — CID 102844876
5-amino-6-(4,5-dibromothiophen-2-yl)piperidin-2-one (PubChem CID 102844876) has the molecular formula C9H10Br2N2OS and a molecular weight of 354.07 g/mol. Its IUPAC name is 5-amino-6-(4,5-dibromothiophen-2-yl)piperidin-2-one.
| Compound Name | 5-amino-6-(4,5-dibromothiophen-2-yl)piperidin-2-one |
|---|---|
| PubChem CID | 102844876 |
| Molecular Formula | C9H10Br2N2OS |
| Molecular Weight | 354.07 g/mol |
| Exact Mass | 351.89 |
| IUPAC Name | 5-amino-6-(4,5-dibromothiophen-2-yl)piperidin-2-one |
| SMILES | NC1CCC(=O)NC1c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H10Br2N2OS/c10-4-3-6(15-9(4)11)8-5(12)1-2-7(14)13-8/h3,5,8H,1-2,12H2,(H,13,14) |
| InChIKey | XYAQCONETNFBFM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.07 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |