About [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol
[1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol (PubChem CID 102849788) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol |
| PubChem CID | 102849788 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol |
| SMILES | OCC1CN(CC2OCCCO2)C1 |
| InChI | InChI=1S/C9H17NO3/c11-7-8-4-10(5-8)6-9-12-2-1-3-13-9/h8-9,11H,1-7H2 |
| InChIKey | ZYOIGNPNHZAFKD-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol?
The IUPAC name of [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol (CID 102849788) is [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol.
What is the SMILES notation for [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol?
The canonical SMILES for [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol is OCC1CN(CC2OCCCO2)C1.
What is the InChIKey of [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol?
The InChIKey is ZYOIGNPNHZAFKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c11-7-8-4-10(5-8)6-9-12-2-1-3-13-9/h8-9,11H,1-7H2.
What are the key properties of [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol?
[1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol has a molecular weight of 187.24 g/mol, XLogP of -0.33, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,3-dioxan-2-ylmethyl)azetidin-3-yl]methanol is sourced from PubChem (CID 102849788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).